C19H20N2O5 — CID 55537711
methyl 5-cyano-6-oxo-1-[2-(4-propoxyphenoxy)ethyl]pyridine-3-carboxylate (PubChem CID 55537711) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl 5-cyano-6-oxo-1-[2-(4-propoxyphenoxy)ethyl]pyridine-3-carboxylate.
| Compound Name | methyl 5-cyano-6-oxo-1-[2-(4-propoxyphenoxy)ethyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55537711 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | methyl 5-cyano-6-oxo-1-[2-(4-propoxyphenoxy)ethyl]pyridine-3-carboxylate |
| SMILES | CCCOc1ccc(OCCn2cc(C(=O)OC)cc(C#N)c2=O)cc1 |
| InChI | InChI=1S/C19H20N2O5/c1-3-9-25-16-4-6-17(7-5-16)26-10-8-21-13-15(19(23)24-2)11-14(12-20)18(21)22/h4-7,11,13H,3,8-10H2,1-2H3 |
| InChIKey | BDYWUXOMMFGDKA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |