C17H22N4O3S2 — CID 55542243
4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]sulfonylbenzamide (PubChem CID 55542243) has the molecular formula C17H22N4O3S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]sulfonylbenzamide.
| Compound Name | 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 55542243 |
| Molecular Formula | C17H22N4O3S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]sulfonylbenzamide |
| SMILES | CCc1nc(CN2CCN(S(=O)(=O)c3ccc(C(N)=O)cc3)CC2)cs1 |
| InChI | InChI=1S/C17H22N4O3S2/c1-2-16-19-14(12-25-16)11-20-7-9-21(10-8-20)26(23,24)15-5-3-13(4-6-15)17(18)22/h3-6,12H,2,7-11H2,1H3,(H2,18,22) |
| InChIKey | TWLYGVYFRAKNGI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |