C24H24F2N2O — CID 55542481
N-benzhydryl-2-[(2,4-difluorophenyl)methyl-methylamino]propanamide (PubChem CID 55542481) has the molecular formula C24H24F2N2O and a molecular weight of 394.47 g/mol. Its IUPAC name is N-benzhydryl-2-[(2,4-difluorophenyl)methyl-methylamino]propanamide.
| Compound Name | N-benzhydryl-2-[(2,4-difluorophenyl)methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 55542481 |
| Molecular Formula | C24H24F2N2O |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-benzhydryl-2-[(2,4-difluorophenyl)methyl-methylamino]propanamide |
| SMILES | CC(C(=O)NC(c1ccccc1)c1ccccc1)N(C)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C24H24F2N2O/c1-17(28(2)16-20-13-14-21(25)15-22(20)26)24(29)27-23(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15,17,23H,16H2,1-2H3,(H,27,29) |
| InChIKey | OQKYTSUJIBTPKU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |