C25H27FN2O2 — CID 9432288
(2S)-N-benzhydryl-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]propanamide (PubChem CID 9432288) has the molecular formula C25H27FN2O2 and a molecular weight of 406.50 g/mol. Its IUPAC name is (2S)-N-benzhydryl-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]propanamide.
| Compound Name | (2S)-N-benzhydryl-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 9432288 |
| Molecular Formula | C25H27FN2O2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (2S)-N-benzhydryl-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]propanamide |
| SMILES | COc1ccc(CN(C)[C@@H](C)C(=O)NC(c2ccccc2)c2ccccc2)cc1F |
| InChI | InChI=1S/C25H27FN2O2/c1-18(28(2)17-19-14-15-23(30-3)22(26)16-19)25(29)27-24(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-16,18,24H,17H2,1-3H3,(H,27,29)/t18-/m0/s1 |
| InChIKey | KEAKKJHIHGOYRR-SFHVURJKSA-N |
| XLogP | 4.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |