C13H18FN3O3 — CID 8681047
(2S)-N-carbamoyl-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]propanamide (PubChem CID 8681047) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]propanamide.
| Compound Name | (2S)-N-carbamoyl-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 8681047 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (2S)-N-carbamoyl-2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]propanamide |
| SMILES | COc1ccc(CN(C)[C@@H](C)C(=O)NC(N)=O)cc1F |
| InChI | InChI=1S/C13H18FN3O3/c1-8(12(18)16-13(15)19)17(2)7-9-4-5-11(20-3)10(14)6-9/h4-6,8H,7H2,1-3H3,(H3,15,16,18,19)/t8-/m0/s1 |
| InChIKey | CGFCUJLDXOBNTK-QMMMGPOBSA-N |
| XLogP | 0.85 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |