C25H19F3N2O3 — CID 55544286
N-(9,10-dioxoanthracen-2-yl)-2-[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]acetamide (PubChem CID 55544286) has the molecular formula C25H19F3N2O3 and a molecular weight of 452.43 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]acetamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]acetamide |
|---|---|
| PubChem CID | 55544286 |
| Molecular Formula | C25H19F3N2O3 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C25H19F3N2O3/c1-30(13-15-6-2-5-9-21(15)25(26,27)28)14-22(31)29-16-10-11-19-20(12-16)24(33)18-8-4-3-7-17(18)23(19)32/h2-12H,13-14H2,1H3,(H,29,31) |
| InChIKey | SGGMSNDRRVWBHP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|