C17H13Cl3N4O3 — CID 55546332
1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 55546332) has the molecular formula C17H13Cl3N4O3 and a molecular weight of 427.68 g/mol. Its IUPAC name is 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 55546332 |
| Molecular Formula | C17H13Cl3N4O3 |
| Molecular Weight | 427.68 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | Cc1ccc(-c2nnc(C(C)OC(=O)c3nc(Cl)c(Cl)c(N)c3Cl)o2)cc1 |
| InChI | InChI=1S/C17H13Cl3N4O3/c1-7-3-5-9(6-4-7)16-24-23-15(27-16)8(2)26-17(25)13-10(18)12(21)11(19)14(20)22-13/h3-6,8H,1-2H3,(H2,21,22) |
| InChIKey | ZIBPMFRGHJINIP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 104.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.68 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|