C17H18N2O5 — CID 9415984
1-O-ethyl 4-O-[(1S)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] (E)-but-2-enedioate (PubChem CID 9415984) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[(1S)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] (E)-but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-[(1S)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 9415984 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-O-ethyl 4-O-[(1S)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)O[C@@H](C)c1nnc(-c2ccc(C)cc2)o1 |
| InChI | InChI=1S/C17H18N2O5/c1-4-22-14(20)9-10-15(21)23-12(3)16-18-19-17(24-16)13-7-5-11(2)6-8-13/h5-10,12H,4H2,1-3H3/b10-9+/t12-/m0/s1 |
| InChIKey | ZWWNBUMKTKJPGA-VMPCVLLUSA-N |
| XLogP | 2.77 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|