C20H25N3O6S — CID 55546453
ethyl 2-[[2-(3-cyclohexyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]-5-ethylthiophene-3-carboxylate (PubChem CID 55546453) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is ethyl 2-[[2-(3-cyclohexyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]-5-ethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(3-cyclohexyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 55546453 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | ethyl 2-[[2-(3-cyclohexyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]-5-ethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)CN1C(=O)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C20H25N3O6S/c1-3-13-10-14(19(27)29-4-2)16(30-13)21-15(24)11-22-17(25)18(26)23(20(22)28)12-8-6-5-7-9-12/h10,12H,3-9,11H2,1-2H3,(H,21,24) |
| InChIKey | NBHFDKSHOAVZSB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|