C15H17BrN2O3S — CID 55551487
4-bromo-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 55551487) has the molecular formula C15H17BrN2O3S and a molecular weight of 385.28 g/mol. Its IUPAC name is 4-bromo-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55551487 |
| Molecular Formula | C15H17BrN2O3S |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 4-bromo-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | CC(c1ccc(S(C)(=O)=O)cc1)N(C)C(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C15H17BrN2O3S/c1-10(11-4-6-13(7-5-11)22(3,20)21)18(2)15(19)14-8-12(16)9-17-14/h4-10,17H,1-3H3 |
| InChIKey | WSQFKQVGWZFDQI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |