C23H30N2O5S2 — CID 55551698
N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-2-(4-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 55551698) has the molecular formula C23H30N2O5S2 and a molecular weight of 478.64 g/mol. Its IUPAC name is N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-2-(4-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-2-(4-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 55551698 |
| Molecular Formula | C23H30N2O5S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-2-(4-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CC(c1ccc(S(C)(=O)=O)cc1)N(C)C(=O)Cc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H30N2O5S2/c1-18(20-9-13-21(14-10-20)31(3,27)28)24(2)23(26)17-19-7-11-22(12-8-19)32(29,30)25-15-5-4-6-16-25/h7-14,18H,4-6,15-17H2,1-3H3 |
| InChIKey | PTPKKCJPIWQSPD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |