C22H29NO3S — CID 55551706
N-methyl-2-[4-(2-methylpropyl)phenyl]-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide (PubChem CID 55551706) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is N-methyl-2-[4-(2-methylpropyl)phenyl]-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide.
| Compound Name | N-methyl-2-[4-(2-methylpropyl)phenyl]-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55551706 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-methyl-2-[4-(2-methylpropyl)phenyl]-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide |
| SMILES | CC(C)Cc1ccc(CC(=O)N(C)C(C)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H29NO3S/c1-16(2)14-18-6-8-19(9-7-18)15-22(24)23(4)17(3)20-10-12-21(13-11-20)27(5,25)26/h6-13,16-17H,14-15H2,1-5H3 |
| InChIKey | YPHJCSWZGMOSTR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |