C23H22N4O — CID 55552636
(2,3-dimethyl-1H-indol-5-yl)-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 55552636) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 55552636 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CC=C(c4c[nH]c5ncccc45)CC3)cc2c1C |
| InChI | InChI=1S/C23H22N4O/c1-14-15(2)26-21-6-5-17(12-19(14)21)23(28)27-10-7-16(8-11-27)20-13-25-22-18(20)4-3-9-24-22/h3-7,9,12-13,26H,8,10-11H2,1-2H3,(H,24,25) |
| InChIKey | ZWNBIMIKONCREW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|