C19H16N4O3 — CID 71943403
(2-nitrophenyl)-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 71943403) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is (2-nitrophenyl)-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (2-nitrophenyl)-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 71943403 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (2-nitrophenyl)-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | O=C(c1ccccc1[N+](=O)[O-])N1CC=C(c2c[nH]c3ncccc23)CC1 |
| InChI | InChI=1S/C19H16N4O3/c24-19(15-4-1-2-6-17(15)23(25)26)22-10-7-13(8-11-22)16-12-21-18-14(16)5-3-9-20-18/h1-7,9,12H,8,10-11H2,(H,20,21) |
| InChIKey | JNUKFZITQYYDPK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|