C20H18Cl2N4O — CID 68708626
N-[chloro-(2-chlorophenyl)methyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 68708626) has the molecular formula C20H18Cl2N4O and a molecular weight of 401.30 g/mol. Its IUPAC name is N-[chloro-(2-chlorophenyl)methyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-[chloro-(2-chlorophenyl)methyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 68708626 |
| Molecular Formula | C20H18Cl2N4O |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-[chloro-(2-chlorophenyl)methyl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | O=C(NC(Cl)c1ccccc1Cl)N1CC=C(c2c[nH]c3ncccc23)CC1 |
| InChI | InChI=1S/C20H18Cl2N4O/c21-17-6-2-1-4-15(17)18(22)25-20(27)26-10-7-13(8-11-26)16-12-24-19-14(16)5-3-9-23-19/h1-7,9,12,18H,8,10-11H2,(H,23,24)(H,25,27) |
| InChIKey | OLNMFARXQSFRRZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|