C15H10F3N3O2S — CID 55554329
2-(furan-2-yl)-N'-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carbohydrazide (PubChem CID 55554329) has the molecular formula C15H10F3N3O2S and a molecular weight of 353.33 g/mol. Its IUPAC name is 2-(furan-2-yl)-N'-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-(furan-2-yl)-N'-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55554329 |
| Molecular Formula | C15H10F3N3O2S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 2-(furan-2-yl)-N'-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carbohydrazide |
| SMILES | O=C(NNc1cccc(C(F)(F)F)c1)c1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C15H10F3N3O2S/c16-15(17,18)9-3-1-4-10(7-9)20-21-13(22)11-8-24-14(19-11)12-5-2-6-23-12/h1-8,20H,(H,21,22) |
| InChIKey | OKNAFUPRLLMTKH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|