C23H23ClN2O3 — CID 55557724
N-[(3-chlorophenyl)methyl]-3-ethoxy-N-methyl-4-(pyridin-4-ylmethoxy)benzamide (PubChem CID 55557724) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-3-ethoxy-N-methyl-4-(pyridin-4-ylmethoxy)benzamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-3-ethoxy-N-methyl-4-(pyridin-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 55557724 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-3-ethoxy-N-methyl-4-(pyridin-4-ylmethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)N(C)Cc2cccc(Cl)c2)ccc1OCc1ccncc1 |
| InChI | InChI=1S/C23H23ClN2O3/c1-3-28-22-14-19(7-8-21(22)29-16-17-9-11-25-12-10-17)23(27)26(2)15-18-5-4-6-20(24)13-18/h4-14H,3,15-16H2,1-2H3 |
| InChIKey | YOOYMLYANFKXQU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |