C20H22F2N4O3 — CID 55558196
2-[(3,4-difluorophenyl)methyl-methylamino]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 55558196) has the molecular formula C20H22F2N4O3 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)methyl-methylamino]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(3,4-difluorophenyl)methyl-methylamino]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55558196 |
| Molecular Formula | C20H22F2N4O3 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-[(3,4-difluorophenyl)methyl-methylamino]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | CN(CC(=O)N1CCN(c2ccccc2[N+](=O)[O-])CC1)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H22F2N4O3/c1-23(13-15-6-7-16(21)17(22)12-15)14-20(27)25-10-8-24(9-11-25)18-4-2-3-5-19(18)26(28)29/h2-7,12H,8-11,13-14H2,1H3 |
| InChIKey | WIAQRWHQHSEIBZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|