C20H28N6O3 — CID 55915888
2-[(1-methylpyrazol-4-yl)methyl-propan-2-ylamino]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 55915888) has the molecular formula C20H28N6O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[(1-methylpyrazol-4-yl)methyl-propan-2-ylamino]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(1-methylpyrazol-4-yl)methyl-propan-2-ylamino]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55915888 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-[(1-methylpyrazol-4-yl)methyl-propan-2-ylamino]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | CC(C)N(CC(=O)N1CCN(c2ccccc2[N+](=O)[O-])CC1)Cc1cnn(C)c1 |
| InChI | InChI=1S/C20H28N6O3/c1-16(2)25(14-17-12-21-22(3)13-17)15-20(27)24-10-8-23(9-11-24)18-6-4-5-7-19(18)26(28)29/h4-7,12-13,16H,8-11,14-15H2,1-3H3 |
| InChIKey | ARVVFOHNLURSQV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 87.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|