C19H23FN2O5S2 — CID 55558714
N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylsulfonylbenzenesulfonamide (PubChem CID 55558714) has the molecular formula C19H23FN2O5S2 and a molecular weight of 442.53 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 55558714 |
| Molecular Formula | C19H23FN2O5S2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccccc1S(=O)(=O)NCC(c1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C19H23FN2O5S2/c1-28(23,24)18-4-2-3-5-19(18)29(25,26)21-14-17(22-10-12-27-13-11-22)15-6-8-16(20)9-7-15/h2-9,17,21H,10-14H2,1H3 |
| InChIKey | AAOHBJOFRVBMKZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |