C19H23ClN2O5S2 — CID 55598948
2-chloro-5-methylsulfonyl-N-(2-morpholin-4-yl-2-phenylethyl)benzenesulfonamide (PubChem CID 55598948) has the molecular formula C19H23ClN2O5S2 and a molecular weight of 458.99 g/mol. Its IUPAC name is 2-chloro-5-methylsulfonyl-N-(2-morpholin-4-yl-2-phenylethyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-methylsulfonyl-N-(2-morpholin-4-yl-2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55598948 |
| Molecular Formula | C19H23ClN2O5S2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 2-chloro-5-methylsulfonyl-N-(2-morpholin-4-yl-2-phenylethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(S(=O)(=O)NCC(c2ccccc2)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H23ClN2O5S2/c1-28(23,24)16-7-8-17(20)19(13-16)29(25,26)21-14-18(15-5-3-2-4-6-15)22-9-11-27-12-10-22/h2-8,13,18,21H,9-12,14H2,1H3 |
| InChIKey | QCWZAISMANYFEB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |