C15H19N3O7 — CID 55562193
methyl 3-[2-(2-methylpropylcarbamoylamino)-2-oxoethoxy]-4-nitrobenzoate (PubChem CID 55562193) has the molecular formula C15H19N3O7 and a molecular weight of 353.33 g/mol. Its IUPAC name is methyl 3-[2-(2-methylpropylcarbamoylamino)-2-oxoethoxy]-4-nitrobenzoate.
| Compound Name | methyl 3-[2-(2-methylpropylcarbamoylamino)-2-oxoethoxy]-4-nitrobenzoate |
|---|---|
| PubChem CID | 55562193 |
| Molecular Formula | C15H19N3O7 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | methyl 3-[2-(2-methylpropylcarbamoylamino)-2-oxoethoxy]-4-nitrobenzoate |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])c(OCC(=O)NC(=O)NCC(C)C)c1 |
| InChI | InChI=1S/C15H19N3O7/c1-9(2)7-16-15(21)17-13(19)8-25-12-6-10(14(20)24-3)4-5-11(12)18(22)23/h4-6,9H,7-8H2,1-3H3,(H2,16,17,19,21) |
| InChIKey | QLHFLRHTPQRUST-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|