C20H23N3O3S2 — CID 55563022
[2-oxo-2-[(2Z)-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinyl]ethyl] 2-thiophen-2-yl-1,3-thiazole-4-carboxylate (PubChem CID 55563022) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is [2-oxo-2-[(2Z)-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinyl]ethyl] 2-thiophen-2-yl-1,3-thiazole-4-carboxylate.
| Compound Name | [2-oxo-2-[(2Z)-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinyl]ethyl] 2-thiophen-2-yl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 55563022 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [2-oxo-2-[(2Z)-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinyl]ethyl] 2-thiophen-2-yl-1,3-thiazole-4-carboxylate |
| SMILES | CC12CCC(C/C1=N/NC(=O)COC(=O)c1csc(-c3cccs3)n1)C2(C)C |
| InChI | InChI=1S/C20H23N3O3S2/c1-19(2)12-6-7-20(19,3)15(9-12)22-23-16(24)10-26-18(25)13-11-28-17(21-13)14-5-4-8-27-14/h4-5,8,11-12H,6-7,9-10H2,1-3H3,(H,23,24)/b22-15- |
| InChIKey | WPOXBCBKLFNMRQ-JCMHNJIXSA-N |
| XLogP | 4.35 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|