C21H29N3O5S — CID 71954156
[2-oxo-2-[2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinyl]ethyl] 3-(ethylsulfamoyl)benzoate (PubChem CID 71954156) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is [2-oxo-2-[2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinyl]ethyl] 3-(ethylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-[2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinyl]ethyl] 3-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 71954156 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | [2-oxo-2-[2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinyl]ethyl] 3-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)OCC(=O)NN=C2CC3CCC2(C)C3(C)C)c1 |
| InChI | InChI=1S/C21H29N3O5S/c1-5-22-30(27,28)16-8-6-7-14(11-16)19(26)29-13-18(25)24-23-17-12-15-9-10-21(17,4)20(15,2)3/h6-8,11,15,22H,5,9-10,12-13H2,1-4H3,(H,24,25) |
| InChIKey | CLSHNNYAXAGWNR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|