C20H30N2O3 — CID 129434383
[2-oxo-2-[2-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl] (1S,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 129434383) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is [2-oxo-2-[2-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl] (1S,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [2-oxo-2-[2-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl] (1S,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 129434383 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | [2-oxo-2-[2-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl] (1S,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=NNC(=O)COC(=O)[C@H]1C[C@H]3CC[C@H]1C3)C2 |
| InChI | InChI=1S/C20H30N2O3/c1-19(2)14-6-7-20(19,3)16(10-14)21-22-17(23)11-25-18(24)15-9-12-4-5-13(15)8-12/h12-15H,4-11H2,1-3H3,(H,22,23)/t12-,13-,14-,15-,20+/m0/s1 |
| InChIKey | DXFIBDJJTJDEHK-ZSORPBTDSA-N |
| XLogP | 3.28 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|