C20H31N3O2S — CID 55565419
N-cyclohexyl-N-methyl-4-[(E)-3-phenylprop-2-enyl]piperazine-1-sulfonamide (PubChem CID 55565419) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-4-[(E)-3-phenylprop-2-enyl]piperazine-1-sulfonamide.
| Compound Name | N-cyclohexyl-N-methyl-4-[(E)-3-phenylprop-2-enyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55565419 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-cyclohexyl-N-methyl-4-[(E)-3-phenylprop-2-enyl]piperazine-1-sulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C20H31N3O2S/c1-21(20-12-6-3-7-13-20)26(24,25)23-17-15-22(16-18-23)14-8-11-19-9-4-2-5-10-19/h2,4-5,8-11,20H,3,6-7,12-18H2,1H3/b11-8+ |
| InChIKey | OFTORPPCQGUYLC-DHZHZOJOSA-N |
| XLogP | 2.83 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |