C23H26N4O5S — CID 55568059
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 4-(2-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 55568059) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 4-(2-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 4-(2-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 55568059 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 4-(2-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc(C(=O)OCCCc2nc(-c3cccnc3)no2)cc1 |
| InChI | InChI=1S/C23H26N4O5S/c1-17-6-2-3-14-27(17)33(29,30)20-11-9-18(10-12-20)23(28)31-15-5-8-21-25-22(26-32-21)19-7-4-13-24-16-19/h4,7,9-13,16-17H,2-3,5-6,8,14-15H2,1H3 |
| InChIKey | UYVRNCKETWWDCK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 115.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|