C24H30N2O5 — CID 55569865
N-(4-butylphenyl)-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 55569865) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is N-(4-butylphenyl)-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(4-butylphenyl)-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55569865 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-(4-butylphenyl)-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)C2CC(=O)N(c3cc(OC)c(OC)c(OC)c3)C2)cc1 |
| InChI | InChI=1S/C24H30N2O5/c1-5-6-7-16-8-10-18(11-9-16)25-24(28)17-12-22(27)26(15-17)19-13-20(29-2)23(31-4)21(14-19)30-3/h8-11,13-14,17H,5-7,12,15H2,1-4H3,(H,25,28) |
| InChIKey | RKUXVSUUKGARQV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |