C24H30N2O8 — CID 55624339
N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 55624339) has the molecular formula C24H30N2O8 and a molecular weight of 474.51 g/mol. Its IUPAC name is N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55624339 |
| Molecular Formula | C24H30N2O8 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | COCCOc1cc(NC(=O)C2CC(=O)N(c3cc(OC)c(OC)c(OC)c3)C2)ccc1OC |
| InChI | InChI=1S/C24H30N2O8/c1-29-8-9-34-19-11-16(6-7-18(19)30-2)25-24(28)15-10-22(27)26(14-15)17-12-20(31-3)23(33-5)21(13-17)32-4/h6-7,11-13,15H,8-10,14H2,1-5H3,(H,25,28) |
| InChIKey | DOIFMHNSYUCCAY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|