C19H15F4N3O2S — CID 55570611
N-(3-fluorophenyl)-3-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]propanamide (PubChem CID 55570611) has the molecular formula C19H15F4N3O2S and a molecular weight of 425.41 g/mol. Its IUPAC name is N-(3-fluorophenyl)-3-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]propanamide.
| Compound Name | N-(3-fluorophenyl)-3-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 55570611 |
| Molecular Formula | C19H15F4N3O2S |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | N-(3-fluorophenyl)-3-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]propanamide |
| SMILES | O=C(CCSCc1nc(-c2cccc(C(F)(F)F)c2)no1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H15F4N3O2S/c20-14-5-2-6-15(10-14)24-16(27)7-8-29-11-17-25-18(26-28-17)12-3-1-4-13(9-12)19(21,22)23/h1-6,9-10H,7-8,11H2,(H,24,27) |
| InChIKey | NYSWKSHLMKGUES-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|