C20H13Cl2N3O4 — CID 55572883
3-(2,6-dichlorophenyl)-5-methyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1,2-oxazole-4-carboxamide (PubChem CID 55572883) has the molecular formula C20H13Cl2N3O4 and a molecular weight of 430.25 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-5-methyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2,6-dichlorophenyl)-5-methyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 55572883 |
| Molecular Formula | C20H13Cl2N3O4 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-5-methyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)Nc1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C20H13Cl2N3O4/c1-9-15(17(24-29-9)16-13(21)4-3-5-14(16)22)18(26)23-10-6-7-11-12(8-10)20(28)25(2)19(11)27/h3-8H,1-2H3,(H,23,26) |
| InChIKey | WIWFZGYZELPWCF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|