C18H18ClF2NO3 — CID 55575443
2-(2-chlorophenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylpropanamide (PubChem CID 55575443) has the molecular formula C18H18ClF2NO3 and a molecular weight of 369.80 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylpropanamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 55575443 |
| Molecular Formula | C18H18ClF2NO3 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylpropanamide |
| SMILES | CC(Oc1ccccc1Cl)C(=O)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H18ClF2NO3/c1-12(24-16-6-4-3-5-15(16)19)17(23)22(2)11-13-7-9-14(10-8-13)25-18(20)21/h3-10,12,18H,11H2,1-2H3 |
| InChIKey | DRKSQIGYZPURRX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |