C18H23FN4O3 — CID 55575810
N-[2-(tert-butylamino)-2-oxoethyl]-N-ethyl-2-(6-fluoro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 55575810) has the molecular formula C18H23FN4O3 and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-N-ethyl-2-(6-fluoro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-N-ethyl-2-(6-fluoro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 55575810 |
| Molecular Formula | C18H23FN4O3 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-N-ethyl-2-(6-fluoro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | CCN(CC(=O)NC(C)(C)C)C(=O)Cn1cnc2ccc(F)cc2c1=O |
| InChI | InChI=1S/C18H23FN4O3/c1-5-22(9-15(24)21-18(2,3)4)16(25)10-23-11-20-14-7-6-12(19)8-13(14)17(23)26/h6-8,11H,5,9-10H2,1-4H3,(H,21,24) |
| InChIKey | IRIFRMDMRZPWTL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |