C21H21NO4 — CID 55577770
N-[(3,5-dimethoxyphenyl)methyl]-2-naphthalen-2-yloxyacetamide (PubChem CID 55577770) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 55577770 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-2-naphthalen-2-yloxyacetamide |
| SMILES | COc1cc(CNC(=O)COc2ccc3ccccc3c2)cc(OC)c1 |
| InChI | InChI=1S/C21H21NO4/c1-24-19-9-15(10-20(12-19)25-2)13-22-21(23)14-26-18-8-7-16-5-3-4-6-17(16)11-18/h3-12H,13-14H2,1-2H3,(H,22,23) |
| InChIKey | XXIOKORAWYZDAW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |