C20H19N5O4 — CID 55578331
N'-[2-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)acetyl]pyridine-2-carbohydrazide (PubChem CID 55578331) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is N'-[2-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)acetyl]pyridine-2-carbohydrazide.
| Compound Name | N'-[2-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)acetyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 55578331 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N'-[2-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)acetyl]pyridine-2-carbohydrazide |
| SMILES | CC12CCC(=O)N1c1ccccc1C(=O)N2CC(=O)NNC(=O)c1ccccn1 |
| InChI | InChI=1S/C20H19N5O4/c1-20-10-9-17(27)25(20)15-8-3-2-6-13(15)19(29)24(20)12-16(26)22-23-18(28)14-7-4-5-11-21-14/h2-8,11H,9-10,12H2,1H3,(H,22,26)(H,23,28) |
| InChIKey | MCJSCJQMVDPNPQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|