C16H16BrFN2O2 — CID 55579968
N-[(5-bromo-2-fluorophenyl)methyl]-2-ethoxy-N-methylpyridine-3-carboxamide (PubChem CID 55579968) has the molecular formula C16H16BrFN2O2 and a molecular weight of 367.22 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-2-ethoxy-N-methylpyridine-3-carboxamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-2-ethoxy-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 55579968 |
| Molecular Formula | C16H16BrFN2O2 |
| Molecular Weight | 367.22 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-2-ethoxy-N-methylpyridine-3-carboxamide |
| SMILES | CCOc1ncccc1C(=O)N(C)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C16H16BrFN2O2/c1-3-22-15-13(5-4-8-19-15)16(21)20(2)10-11-9-12(17)6-7-14(11)18/h4-9H,3,10H2,1-2H3 |
| InChIKey | WVPNOSCMXLSZDQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |