C17H19BrN2O4 — CID 55580820
5-bromo-N-[2-[1-(2-methoxyphenyl)ethyl-methylamino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 55580820) has the molecular formula C17H19BrN2O4 and a molecular weight of 395.25 g/mol. Its IUPAC name is 5-bromo-N-[2-[1-(2-methoxyphenyl)ethyl-methylamino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[1-(2-methoxyphenyl)ethyl-methylamino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55580820 |
| Molecular Formula | C17H19BrN2O4 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 5-bromo-N-[2-[1-(2-methoxyphenyl)ethyl-methylamino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | COc1ccccc1C(C)N(C)C(=O)CNC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C17H19BrN2O4/c1-11(12-6-4-5-7-13(12)23-3)20(2)16(21)10-19-17(22)14-8-9-15(18)24-14/h4-9,11H,10H2,1-3H3,(H,19,22) |
| InChIKey | NCBKFNVJQHOMND-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |