C22H26BrN3O — CID 55584860
[6-(3-bromophenyl)-2-methyl-3-pyridinyl]-(4-cyclopentylpiperazin-1-yl)methanone (PubChem CID 55584860) has the molecular formula C22H26BrN3O and a molecular weight of 428.37 g/mol. Its IUPAC name is [6-(3-bromophenyl)-2-methyl-3-pyridinyl]-(4-cyclopentylpiperazin-1-yl)methanone.
| Compound Name | [6-(3-bromophenyl)-2-methyl-3-pyridinyl]-(4-cyclopentylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 55584860 |
| Molecular Formula | C22H26BrN3O |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | [6-(3-bromophenyl)-2-methyl-3-pyridinyl]-(4-cyclopentylpiperazin-1-yl)methanone |
| SMILES | Cc1nc(-c2cccc(Br)c2)ccc1C(=O)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C22H26BrN3O/c1-16-20(9-10-21(24-16)17-5-4-6-18(23)15-17)22(27)26-13-11-25(12-14-26)19-7-2-3-8-19/h4-6,9-10,15,19H,2-3,7-8,11-14H2,1H3 |
| InChIKey | VYABUISDWFLUGV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |