C22H20BrClN4O — CID 55860227
[6-(3-bromophenyl)-2-methyl-3-pyridinyl]-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]methanone (PubChem CID 55860227) has the molecular formula C22H20BrClN4O and a molecular weight of 471.79 g/mol. Its IUPAC name is [6-(3-bromophenyl)-2-methyl-3-pyridinyl]-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]methanone.
| Compound Name | [6-(3-bromophenyl)-2-methyl-3-pyridinyl]-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55860227 |
| Molecular Formula | C22H20BrClN4O |
| Molecular Weight | 471.79 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | [6-(3-bromophenyl)-2-methyl-3-pyridinyl]-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]methanone |
| SMILES | Cc1nc(-c2cccc(Br)c2)ccc1C(=O)N1CCN(c2cccc(Cl)n2)CC1 |
| InChI | InChI=1S/C22H20BrClN4O/c1-15-18(8-9-19(25-15)16-4-2-5-17(23)14-16)22(29)28-12-10-27(11-13-28)21-7-3-6-20(24)26-21/h2-9,14H,10-13H2,1H3 |
| InChIKey | INEFIGAGAPKVTE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.79 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|