C15H19FO2Si — CID 555859
2-benzyl-5-[fluoro(dimethyl)silyl]cyclohexane-1,3-dione (PubChem CID 555859) has the molecular formula C15H19FO2Si and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-benzyl-5-[fluoro(dimethyl)silyl]cyclohexane-1,3-dione.
| Compound Name | 2-benzyl-5-[fluoro(dimethyl)silyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 555859 |
| Molecular Formula | C15H19FO2Si |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-benzyl-5-[fluoro(dimethyl)silyl]cyclohexane-1,3-dione |
| SMILES | C[Si](C)(F)C1CC(=O)C(Cc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C15H19FO2Si/c1-19(2,16)12-9-14(17)13(15(18)10-12)8-11-6-4-3-5-7-11/h3-7,12-13H,8-10H2,1-2H3 |
| InChIKey | ZMTLIABPEVFEFG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|