C22H31NO3 — CID 55587895
(E)-N-cyclohexyl-N-cyclopropyl-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide (PubChem CID 55587895) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is (E)-N-cyclohexyl-N-cyclopropyl-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-cyclohexyl-N-cyclopropyl-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55587895 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (E)-N-cyclohexyl-N-cyclopropyl-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(C2CCCCC2)C2CC2)ccc1OC(C)C |
| InChI | InChI=1S/C22H31NO3/c1-16(2)26-20-13-9-17(15-21(20)25-3)10-14-22(24)23(19-11-12-19)18-7-5-4-6-8-18/h9-10,13-16,18-19H,4-8,11-12H2,1-3H3/b14-10+ |
| InChIKey | QLRCTPFPESFVIE-GXDHUFHOSA-N |
| XLogP | 4.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|