C25H29N3O — CID 55588344
4-(3,5-dimethylpyrazol-1-yl)-N-methyl-N-(4-phenylcyclohexyl)benzamide (PubChem CID 55588344) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-N-methyl-N-(4-phenylcyclohexyl)benzamide.
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-N-methyl-N-(4-phenylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 55588344 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-N-methyl-N-(4-phenylcyclohexyl)benzamide |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)N(C)C3CCC(c4ccccc4)CC3)cc2)n1 |
| InChI | InChI=1S/C25H29N3O/c1-18-17-19(2)28(26-18)24-15-11-22(12-16-24)25(29)27(3)23-13-9-21(10-14-23)20-7-5-4-6-8-20/h4-8,11-12,15-17,21,23H,9-10,13-14H2,1-3H3 |
| InChIKey | KUEOKOMAVKBOAI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |