C29H39N3O3 — CID 55591893
[1-(adamantane-1-carbonyl)pyrrolidin-2-yl]-[4-(4-ethylbenzoyl)piperazin-1-yl]methanone (PubChem CID 55591893) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is [1-(adamantane-1-carbonyl)pyrrolidin-2-yl]-[4-(4-ethylbenzoyl)piperazin-1-yl]methanone.
| Compound Name | [1-(adamantane-1-carbonyl)pyrrolidin-2-yl]-[4-(4-ethylbenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55591893 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | [1-(adamantane-1-carbonyl)pyrrolidin-2-yl]-[4-(4-ethylbenzoyl)piperazin-1-yl]methanone |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)C3CCCN3C(=O)C34CC5CC(CC(C5)C3)C4)CC2)cc1 |
| InChI | InChI=1S/C29H39N3O3/c1-2-20-5-7-24(8-6-20)26(33)30-10-12-31(13-11-30)27(34)25-4-3-9-32(25)28(35)29-17-21-14-22(18-29)16-23(15-21)19-29/h5-8,21-23,25H,2-4,9-19H2,1H3 |
| InChIKey | ZPZYRUUCEXGUCU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |