C25H40N4O3 — CID 55372659
2-[4-[1-(adamantane-1-carbonyl)pyrrolidine-2-carbonyl]piperazin-1-yl]-N-propylacetamide (PubChem CID 55372659) has the molecular formula C25H40N4O3 and a molecular weight of 444.62 g/mol. Its IUPAC name is 2-[4-[1-(adamantane-1-carbonyl)pyrrolidine-2-carbonyl]piperazin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[1-(adamantane-1-carbonyl)pyrrolidine-2-carbonyl]piperazin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 55372659 |
| Molecular Formula | C25H40N4O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 2-[4-[1-(adamantane-1-carbonyl)pyrrolidine-2-carbonyl]piperazin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCN(C(=O)C2CCCN2C(=O)C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C25H40N4O3/c1-2-5-26-22(30)17-27-7-9-28(10-8-27)23(31)21-4-3-6-29(21)24(32)25-14-18-11-19(15-25)13-20(12-18)16-25/h18-21H,2-17H2,1H3,(H,26,30) |
| InChIKey | INYSYTOSMIGXKE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |