C22H24N2O4 — CID 55593558
2-(4-acetyl-2-methoxyphenoxy)-N-[(4-cyanophenyl)methyl]-N-propylacetamide (PubChem CID 55593558) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyphenoxy)-N-[(4-cyanophenyl)methyl]-N-propylacetamide.
| Compound Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[(4-cyanophenyl)methyl]-N-propylacetamide |
|---|---|
| PubChem CID | 55593558 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[(4-cyanophenyl)methyl]-N-propylacetamide |
| SMILES | CCCN(Cc1ccc(C#N)cc1)C(=O)COc1ccc(C(C)=O)cc1OC |
| InChI | InChI=1S/C22H24N2O4/c1-4-11-24(14-18-7-5-17(13-23)6-8-18)22(26)15-28-20-10-9-19(16(2)25)12-21(20)27-3/h5-10,12H,4,11,14-15H2,1-3H3 |
| InChIKey | LOOUEMHBLYSRPU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |