C18H18BrNO2S — CID 55594001
N-[(3-bromophenyl)methyl]-N-cyclopropyl-4-methylsulfinylbenzamide (PubChem CID 55594001) has the molecular formula C18H18BrNO2S and a molecular weight of 392.32 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N-cyclopropyl-4-methylsulfinylbenzamide.
| Compound Name | N-[(3-bromophenyl)methyl]-N-cyclopropyl-4-methylsulfinylbenzamide |
|---|---|
| PubChem CID | 55594001 |
| Molecular Formula | C18H18BrNO2S |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N-cyclopropyl-4-methylsulfinylbenzamide |
| SMILES | CS(=O)c1ccc(C(=O)N(Cc2cccc(Br)c2)C2CC2)cc1 |
| InChI | InChI=1S/C18H18BrNO2S/c1-23(22)17-9-5-14(6-10-17)18(21)20(16-7-8-16)12-13-3-2-4-15(19)11-13/h2-6,9-11,16H,7-8,12H2,1H3 |
| InChIKey | KNOAEIHHORXZCL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |