C18H15ClF3N3O2S — CID 55597555
1-[(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoyl]-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 55597555) has the molecular formula C18H15ClF3N3O2S and a molecular weight of 429.85 g/mol. Its IUPAC name is 1-[(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoyl]-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoyl]-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55597555 |
| Molecular Formula | C18H15ClF3N3O2S |
| Molecular Weight | 429.85 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 1-[(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoyl]-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1nccs1)C1CCCN1C(=O)/C=C/c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15ClF3N3O2S/c19-13-5-3-11(10-12(13)18(20,21)22)4-6-15(26)25-8-1-2-14(25)16(27)24-17-23-7-9-28-17/h3-7,9-10,14H,1-2,8H2,(H,23,24,27)/b6-4+ |
| InChIKey | DISBKLDGYRYEJW-GQCTYLIASA-N |
| XLogP | 4.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.85 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|