C21H19N3O2S — CID 134037190
1-[(E)-3-naphthalen-1-ylprop-2-enoyl]-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 134037190) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 1-[(E)-3-naphthalen-1-ylprop-2-enoyl]-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[(E)-3-naphthalen-1-ylprop-2-enoyl]-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 134037190 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-[(E)-3-naphthalen-1-ylprop-2-enoyl]-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1nccs1)C1CCCN1C(=O)/C=C/c1cccc2ccccc12 |
| InChI | InChI=1S/C21H19N3O2S/c25-19(11-10-16-7-3-6-15-5-1-2-8-17(15)16)24-13-4-9-18(24)20(26)23-21-22-12-14-27-21/h1-3,5-8,10-12,14,18H,4,9,13H2,(H,22,23,26)/b11-10+ |
| InChIKey | VEJBAYNLXZEALE-ZHACJKMWSA-N |
| XLogP | 3.94 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|