C24H26N4O2S — CID 42961197
1-N-(3,3-diphenylpropyl)-2-N-(1,3-thiazol-2-yl)pyrrolidine-1,2-dicarboxamide (PubChem CID 42961197) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 1-N-(3,3-diphenylpropyl)-2-N-(1,3-thiazol-2-yl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 1-N-(3,3-diphenylpropyl)-2-N-(1,3-thiazol-2-yl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 42961197 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-N-(3,3-diphenylpropyl)-2-N-(1,3-thiazol-2-yl)pyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(Nc1nccs1)C1CCCN1C(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26N4O2S/c29-22(27-23-25-15-17-31-23)21-12-7-16-28(21)24(30)26-14-13-20(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-11,15,17,20-21H,7,12-14,16H2,(H,26,30)(H,25,27,29) |
| InChIKey | IQUMIGBDENIDFR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |