C24H26ClN3O3 — CID 55597795
1-(4-chlorobenzoyl)-N-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]piperidine-3-carboxamide (PubChem CID 55597795) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55597795 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(CN2CCCC2=O)c1)C1CCCN(C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H26ClN3O3/c25-20-10-8-18(9-11-20)24(31)28-13-2-5-19(16-28)23(30)26-21-6-1-4-17(14-21)15-27-12-3-7-22(27)29/h1,4,6,8-11,14,19H,2-3,5,7,12-13,15-16H2,(H,26,30) |
| InChIKey | CZZXDXQUPWZABP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |